C12H15N — CID 135331231
6-prop-1-en-2-yl-2,3-dihydro-1H-inden-5-amine (PubChem CID 135331231) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 6-prop-1-en-2-yl-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 135331231 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 6-prop-1-en-2-yl-2,3-dihydro-1H-inden-5-amine |
| SMILES | C=C(C)c1cc2c(cc1N)CCC2 |
| InChI | InChI=1S/C12H15N/c1-8(2)11-6-9-4-3-5-10(9)7-12(11)13/h6-7H,1,3-5,13H2,2H3 |
| InChIKey | NZDUMTZFMPZUEB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|