C4H3KN10O4 — CID 135485772
potassium N-[3-(5-nitramido-1,2-diaza-4-azanidacyclopenta-2,5-dien-3-yl)-1H-1,2,4-triazol-5-yl]nitramide (PubChem CID 135485772) has the molecular formula C4H3KN10O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is potassium N-[3-(5-nitramido-1,2-diaza-4-azanidacyclopenta-2,5-dien-3-yl)-1H-1,2,4-triazol-5-yl]nitramide.
| Compound Name | potassium N-[3-(5-nitramido-1,2-diaza-4-azanidacyclopenta-2,5-dien-3-yl)-1H-1,2,4-triazol-5-yl]nitramide |
|---|---|
| PubChem CID | 135485772 |
| Molecular Formula | C4H3KN10O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | potassium N-[3-(5-nitramido-1,2-diaza-4-azanidacyclopenta-2,5-dien-3-yl)-1H-1,2,4-triazol-5-yl]nitramide |
| SMILES | O=[N+]([O-])Nc1nnc(-c2n[nH]c(N[N+](=O)[O-])n2)[n-]1.[K+] |
| InChI | InChI=1S/C4H3N10O4.K/c15-13(16)11-3-5-1(7-9-3)2-6-4(10-8-2)12-14(17)18;/h(H3-,5,6,7,8,9,10,11,12);/q-1;+1 |
| InChIKey | IZNCXXRRPQMKKN-UHFFFAOYSA-N |
| XLogP | -4.57 |
| TPSA | 191.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|