C15H12Cl3N4O+ — CID 135577234
4-amino-3,5,6-trichloro-N-(1,3-dihydroinden-2-ylideneamino)pyridin-1-ium-2-carboxamide (PubChem CID 135577234) has the molecular formula C15H12Cl3N4O+ and a molecular weight of 370.65 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-(1,3-dihydroinden-2-ylideneamino)pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-(1,3-dihydroinden-2-ylideneamino)pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135577234 |
| Molecular Formula | C15H12Cl3N4O+ |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-(1,3-dihydroinden-2-ylideneamino)pyridin-1-ium-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)[nH+]c(C(=O)NN=C2Cc3ccccc3C2)c1Cl |
| InChI | InChI=1S/C15H11Cl3N4O/c16-10-12(19)11(17)14(18)20-13(10)15(23)22-21-9-5-7-3-1-2-4-8(7)6-9/h1-4H,5-6H2,(H2,19,20)(H,22,23)/p+1 |
| InChIKey | KOOFTHGBKHUBRM-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|