C19H17BrN6O5 — CID 135908793
methyl (E)-2-(1H-benzimidazol-2-yl)-4-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-3-hydroxybut-2-enoate (PubChem CID 135908793) has the molecular formula C19H17BrN6O5 and a molecular weight of 489.29 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135908793 |
| Molecular Formula | C19H17BrN6O5 |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/O)Cn1c(Br)nc2c(=O)n(C)c(=O)n(C)c21)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H17BrN6O5/c1-24-15-13(16(28)25(2)19(24)30)23-18(20)26(15)8-11(27)12(17(29)31-3)14-21-9-6-4-5-7-10(9)22-14/h4-7,27H,8H2,1-3H3,(H,21,22)/b12-11+ |
| InChIKey | DHFWDCRXDLALFB-VAWYXSNFSA-N |
| XLogP | 1.21 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|