C30H26BrIN2O11 — CID 135912087
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-bromo-2-hydroxy-3-(5-iodo-2-oxoindol-3-yl)indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 135912087) has the molecular formula C30H26BrIN2O11 and a molecular weight of 797.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-bromo-2-hydroxy-3-(5-iodo-2-oxoindol-3-yl)indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-bromo-2-hydroxy-3-(5-iodo-2-oxoindol-3-yl)indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135912087 |
| Molecular Formula | C30H26BrIN2O11 |
| Molecular Weight | 797.35 g/mol |
| Exact Mass | 795.98 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-bromo-2-hydroxy-3-(5-iodo-2-oxoindol-3-yl)indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(O)c(C3=c4cc(I)ccc4=NC3=O)c3cc(Br)ccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H26BrIN2O11/c1-12(35)41-11-22-25(42-13(2)36)26(43-14(3)37)27(44-15(4)38)30(45-22)34-21-8-5-16(31)9-19(21)24(29(34)40)23-18-10-17(32)6-7-20(18)33-28(23)39/h5-10,22,25-27,30,40H,11H2,1-4H3/t22-,25-,26+,27-,30-/m1/s1 |
| InChIKey | KTTNEZRZBMHBIJ-FRLFRUAOSA-N |
| XLogP | 2.33 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|