C30H27ClN2O13S — CID 135925353
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(5-chlorosulfonyl-2-oxoindol-3-yl)-2-hydroxyindol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 135925353) has the molecular formula C30H27ClN2O13S and a molecular weight of 691.07 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(5-chlorosulfonyl-2-oxoindol-3-yl)-2-hydroxyindol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(5-chlorosulfonyl-2-oxoindol-3-yl)-2-hydroxyindol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135925353 |
| Molecular Formula | C30H27ClN2O13S |
| Molecular Weight | 691.07 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(5-chlorosulfonyl-2-oxoindol-3-yl)-2-hydroxyindol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(O)c(C3=c4cc(S(=O)(=O)Cl)ccc4=NC3=O)c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H27ClN2O13S/c1-13(34)42-12-22-25(43-14(2)35)26(44-15(3)36)27(45-16(4)37)30(46-22)33-21-8-6-5-7-18(21)24(29(33)39)23-19-11-17(47(31,40)41)9-10-20(19)32-28(23)38/h5-11,22,25-27,30,39H,12H2,1-4H3/t22-,25-,26+,27-,30-/m1/s1 |
| InChIKey | BPGGJAHUDFKZLV-FRLFRUAOSA-N |
| XLogP | 0.89 |
| TPSA | 203.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.07 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|