C21H21N7O5 — CID 135936639
3-hexyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-1H-benzo[g]pteridine-2,4-dione (PubChem CID 135936639) has the molecular formula C21H21N7O5 and a molecular weight of 451.44 g/mol. Its IUPAC name is 3-hexyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-1H-benzo[g]pteridine-2,4-dione.
| Compound Name | 3-hexyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-1H-benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 135936639 |
| Molecular Formula | C21H21N7O5 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-hexyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-1H-benzo[g]pteridine-2,4-dione |
| SMILES | CCCCCCn1c(=O)[nH]c2nc3cc(/N=C/c4c(O)[nH]c(=O)[nH]c4=O)ccc3nc2c1=O |
| InChI | InChI=1S/C21H21N7O5/c1-2-3-4-5-8-28-19(31)15-16(25-21(28)33)24-14-9-11(6-7-13(14)23-15)22-10-12-17(29)26-20(32)27-18(12)30/h6-7,9-10H,2-5,8H2,1H3,(H,24,25,33)(H3,26,27,29,30,32)/b22-10+ |
| InChIKey | SKAZUGOFODYLML-LSHDLFTRSA-N |
| XLogP | 1.05 |
| TPSA | 178.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|