C23H15Cl2N5OS — CID 136594990
2-(2,6-dichlorophenyl)imino-5-[(1-methyl-2-pyridin-3-ylbenzimidazol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136594990) has the molecular formula C23H15Cl2N5OS and a molecular weight of 480.38 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)imino-5-[(1-methyl-2-pyridin-3-ylbenzimidazol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,6-dichlorophenyl)imino-5-[(1-methyl-2-pyridin-3-ylbenzimidazol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136594990 |
| Molecular Formula | C23H15Cl2N5OS |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)imino-5-[(1-methyl-2-pyridin-3-ylbenzimidazol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cn1c(-c2cccnc2)nc2cc(C=C3S/C(=N\c4c(Cl)cccc4Cl)NC3=O)ccc21 |
| InChI | InChI=1S/C23H15Cl2N5OS/c1-30-18-8-7-13(10-17(18)27-21(30)14-4-3-9-26-12-14)11-19-22(31)29-23(32-19)28-20-15(24)5-2-6-16(20)25/h2-12H,1H3,(H,28,29,31) |
| InChIKey | MNVHMTQQPSNILA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|