About N,N-dimethylbutan-1-amine
N,N-dimethylbutan-1-amine (PubChem CID 136646688) has the molecular formula C6H14N+
and a molecular weight of 100.19 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N,N-dimethylbutan-1-amine |
| PubChem CID | 136646688 |
| Molecular Formula | C6H14N+ |
| Molecular Weight | 100.19 g/mol |
| Exact Mass | 100.11 |
| IUPAC Name | N,N-dimethylbutan-1-amine |
| SMILES | [CH2+]CCCN(C)C |
| InChI | InChI=1S/C6H14N/c1-4-5-6-7(2)3/h1,4-6H2,2-3H3/q+1 |
| InChIKey | SYBNEQUKHCESBW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylbutan-1-amine?
The IUPAC name of N,N-dimethylbutan-1-amine (CID 136646688) is N,N-dimethylbutan-1-amine.
What is the SMILES notation for N,N-dimethylbutan-1-amine?
The canonical SMILES for N,N-dimethylbutan-1-amine is [CH2+]CCCN(C)C.
What is the InChIKey of N,N-dimethylbutan-1-amine?
The InChIKey is SYBNEQUKHCESBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N/c1-4-5-6-7(2)3/h1,4-6H2,2-3H3/q+1.
What are the key properties of N,N-dimethylbutan-1-amine?
N,N-dimethylbutan-1-amine has a molecular weight of 100.19 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylbutan-1-amine is sourced from PubChem (CID 136646688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).