C6H14N+ — CID 136646688
N,N-dimethylbutan-1-amine (PubChem CID 136646688) has the molecular formula C6H14N+ and a molecular weight of 100.19 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine.
| Compound Name | N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 136646688 |
| Molecular Formula | C6H14N+ |
| Molecular Weight | 100.19 g/mol |
| Exact Mass | 100.11 |
| IUPAC Name | N,N-dimethylbutan-1-amine |
| SMILES | [CH2+]CCCN(C)C |
| InChI | InChI=1S/C6H14N/c1-4-5-6-7(2)3/h1,4-6H2,2-3H3/q+1 |
| InChIKey | SYBNEQUKHCESBW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|