C19H25FN4O3 — CID 136655278
tert-butyl N-[(5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamate (PubChem CID 136655278) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is tert-butyl N-[(5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamate.
| Compound Name | tert-butyl N-[(5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamate |
|---|---|
| PubChem CID | 136655278 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | tert-butyl N-[(5R,7S)-1-(3-fluorophenyl)-7-methyl-2-oxo-1,3,8-triazaspiro[4.5]decan-4-ylidene]carbamate |
| SMILES | C[C@H]1C[C@]2(CCN1)C(=NC(=O)OC(C)(C)C)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN4O3/c1-12-11-19(8-9-21-12)15(23-17(26)27-18(2,3)4)22-16(25)24(19)14-7-5-6-13(20)10-14/h5-7,10,12,21H,8-9,11H2,1-4H3,(H,22,23,25,26)/t12-,19+/m0/s1 |
| InChIKey | DZEGWVXZXXFMNG-HXPMCKFVSA-N |
| XLogP | 3.20 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|