C23H32F2N4O — CID 137298801
4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(3-methylbutyl)-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298801) has the molecular formula C23H32F2N4O and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(3-methylbutyl)-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(3-methylbutyl)-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298801 |
| Molecular Formula | C23H32F2N4O |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(3-methylbutyl)-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | CC(C)CCN1CCCC2(C1)/C(=N/C1CCCC1)NC(=O)N2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H32F2N4O/c1-16(2)8-11-28-10-5-9-23(15-28)21(26-19-6-3-4-7-19)27-22(30)29(23)20-13-17(24)12-18(25)14-20/h12-14,16,19H,3-11,15H2,1-2H3,(H,26,27,30) |
| InChIKey | TXEZNSVAEFBDQO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|