C26H36F2N4O — CID 137298723
4-cyclohexylimino-9-(cyclohexylmethyl)-1-(3,5-difluorophenyl)-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298723) has the molecular formula C26H36F2N4O and a molecular weight of 458.60 g/mol. Its IUPAC name is 4-cyclohexylimino-9-(cyclohexylmethyl)-1-(3,5-difluorophenyl)-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-9-(cyclohexylmethyl)-1-(3,5-difluorophenyl)-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298723 |
| Molecular Formula | C26H36F2N4O |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 4-cyclohexylimino-9-(cyclohexylmethyl)-1-(3,5-difluorophenyl)-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCCN(CC3CCCCC3)C2)N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C26H36F2N4O/c27-20-14-21(28)16-23(15-20)32-25(33)30-24(29-22-10-5-2-6-11-22)26(32)12-7-13-31(18-26)17-19-8-3-1-4-9-19/h14-16,19,22H,1-13,17-18H2,(H,29,30,33) |
| InChIKey | WDJDPCHBGKCODH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|