C26H31F2N5O — CID 137298881
4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298881) has the molecular formula C26H31F2N5O and a molecular weight of 467.56 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298881 |
| Molecular Formula | C26H31F2N5O |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | CN(C)c1ccc(CN2CCC3(C2)/C(=N/C2CCCC2)NC(=O)N3c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C26H31F2N5O/c1-31(2)22-9-7-18(8-10-22)16-32-12-11-26(17-32)24(29-21-5-3-4-6-21)30-25(34)33(26)23-14-19(27)13-20(28)15-23/h7-10,13-15,21H,3-6,11-12,16-17H2,1-2H3,(H,29,30,34) |
| InChIKey | AAVHCUVSZZOKHJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|