C22H30F2N4O — CID 137298729
4-cyclopentylimino-1-(3,5-difluorophenyl)-7-(3-methylbutyl)-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298729) has the molecular formula C22H30F2N4O and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-(3-methylbutyl)-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-(3-methylbutyl)-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298729 |
| Molecular Formula | C22H30F2N4O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-(3-methylbutyl)-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | CC(C)CCN1CCC2(C1)/C(=N/C1CCCC1)NC(=O)N2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H30F2N4O/c1-15(2)7-9-27-10-8-22(14-27)20(25-18-5-3-4-6-18)26-21(29)28(22)19-12-16(23)11-17(24)13-19/h11-13,15,18H,3-10,14H2,1-2H3,(H,25,26,29) |
| InChIKey | VUVVPHLLFVBEFN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|