C50H46N6 — CID 136675189
3-[10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]prop-2-ynimidamide (PubChem CID 136675189) has the molecular formula C50H46N6 and a molecular weight of 730.96 g/mol. Its IUPAC name is 3-[10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]prop-2-ynimidamide.
| Compound Name | 3-[10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]prop-2-ynimidamide |
|---|---|
| PubChem CID | 136675189 |
| Molecular Formula | C50H46N6 |
| Molecular Weight | 730.96 g/mol |
| Exact Mass | 730.38 |
| IUPAC Name | 3-[10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]prop-2-ynimidamide |
| SMILES | [H]/N=C(\N)C#Cc1c2nc(c(-c3c(C)cc(C)cc3C)c3ccc([nH]3)c(-c3c(C)cc(C)cc3C)c3nc(c(-c4c(C)cc(C)cc4C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C50H46N6/c1-26-20-29(4)45(30(5)21-26)48-38-13-11-36(53-38)35(10-19-44(51)52)37-12-14-39(54-37)49(46-31(6)22-27(2)23-32(46)7)41-16-18-43(56-41)50(42-17-15-40(48)55-42)47-33(8)24-28(3)25-34(47)9/h11-18,20-25,53,56H,1-9H3,(H3,51,52)/b36-35-,37-35-,48-38+,48-40+,49-39+,49-41+,50-42+,50-43+ |
| InChIKey | BNHFFHNOYJPQTR-PZSLYGRQSA-N |
| XLogP | 11.72 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.96 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|