C66H80N2O5 — CID 136734668
4-[5-[3,4-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl]benzoic acid (PubChem CID 136734668) has the molecular formula C66H80N2O5 and a molecular weight of 981.37 g/mol. Its IUPAC name is 4-[5-[3,4-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl]benzoic acid.
| Compound Name | 4-[5-[3,4-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl]benzoic acid |
|---|---|
| PubChem CID | 136734668 |
| Molecular Formula | C66H80N2O5 |
| Molecular Weight | 981.37 g/mol |
| Exact Mass | 980.61 |
| IUPAC Name | 4-[5-[3,4-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl]benzoic acid |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccc(-c3cc(C(C)(C)C)cc4c3Oc3c(-c5ccc(C(=O)O)cc5)cc(C(C)(C)C)cc3C4(C)C)cc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C66H80N2O5/c1-60(2,3)43-27-41(55(69)49(32-43)64(13,14)15)36-67-53-26-25-40(29-54(53)68-37-42-28-44(61(4,5)6)33-50(56(42)70)65(16,17)18)48-31-46(63(10,11)12)35-52-58(48)73-57-47(38-21-23-39(24-22-38)59(71)72)30-45(62(7,8)9)34-51(57)66(52,19)20/h21-37,69-70H,1-20H3,(H,71,72)/b67-36+,68-37+ |
| InChIKey | GBZLFXYWZGPMQK-VTFIAUISSA-N |
| XLogP | 17.85 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.37 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|