C20H17Br2N3O5 — CID 136915793
methyl 2-[2-bromo-4-[(Z)-[(E)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate (PubChem CID 136915793) has the molecular formula C20H17Br2N3O5 and a molecular weight of 539.18 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(Z)-[(E)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(Z)-[(E)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 136915793 |
| Molecular Formula | C20H17Br2N3O5 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | methyl 2-[2-bromo-4-[(Z)-[(E)-(5-bromo-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=N\N=C2\C(=O)Nc3ccc(Br)cc32)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C20H17Br2N3O5/c1-3-29-16-7-11(6-14(22)19(16)30-10-17(26)28-2)9-23-25-18-13-8-12(21)4-5-15(13)24-20(18)27/h4-9H,3,10H2,1-2H3,(H,24,25,27)/b23-9- |
| InChIKey | PLFBNVGDKLEJNF-AQHIEDMUSA-N |
| XLogP | 3.94 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|