C16H11F4NO4 — CID 137162750
3-[2,3,5,6-tetrafluoro-4-(iminomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 137162750) has the molecular formula C16H11F4NO4 and a molecular weight of 357.26 g/mol. Its IUPAC name is 3-[2,3,5,6-tetrafluoro-4-(iminomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[2,3,5,6-tetrafluoro-4-(iminomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 137162750 |
| Molecular Formula | C16H11F4NO4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-[2,3,5,6-tetrafluoro-4-(iminomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | N=C=c1c(F)c(F)c(=C2C(=O)OC3(CCCCC3)OC2=O)c(F)c1F |
| InChI | InChI=1S/C16H11F4NO4/c17-10-7(6-21)11(18)13(20)8(12(10)19)9-14(22)24-16(25-15(9)23)4-2-1-3-5-16/h21H,1-5H2 |
| InChIKey | CWDWJRTXTZVLAC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|