C19H32ClN3O5S — CID 137488061
5-[(E)-3-aminoprop-1-enyl]-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide (PubChem CID 137488061) has the molecular formula C19H32ClN3O5S and a molecular weight of 450.00 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide.
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide |
|---|---|
| PubChem CID | 137488061 |
| Molecular Formula | C19H32ClN3O5S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-2,3,6,7-tetrahydro-1H-azepine-2-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2CC=C(/C=C/CN)CCN2)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C19H32ClN3O5S/c1-10(20)13(17-15(25)14(24)16(26)19(28-17)29-2)23-18(27)12-6-5-11(4-3-8-21)7-9-22-12/h3-5,10,12-17,19,22,24-26H,6-9,21H2,1-2H3,(H,23,27)/b4-3+ |
| InChIKey | LZUHTPUKZXMKSD-ONEGZZNKSA-N |
| XLogP | -0.54 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|