C32H51N2O6PS — CID 138505594
ethyl 2-[[[2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butoxy]-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate (PubChem CID 138505594) has the molecular formula C32H51N2O6PS and a molecular weight of 622.81 g/mol. Its IUPAC name is ethyl 2-[[[2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butoxy]-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl 2-[[[2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butoxy]-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 138505594 |
| Molecular Formula | C32H51N2O6PS |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | ethyl 2-[[[2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butoxy]-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)COP(=O)(NC(CCSC)C(=O)OCC)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H51N2O6PS/c1-4-6-7-8-9-11-14-27-17-19-28(20-18-27)21-23-32(33,25-35)26-39-41(37,40-29-15-12-10-13-16-29)34-30(22-24-42-3)31(36)38-5-2/h10,12-13,15-20,30,35H,4-9,11,14,21-26,33H2,1-3H3,(H,34,37) |
| InChIKey | NWUBECLUICTIBW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|