C27H41N2O7P — CID 138514999
pentyl (2S)-2-[[[2-amino-2-(hydroxymethyl)-4-(4-methylphenyl)butoxy]-(4-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 138514999) has the molecular formula C27H41N2O7P and a molecular weight of 536.61 g/mol. Its IUPAC name is pentyl (2S)-2-[[[2-amino-2-(hydroxymethyl)-4-(4-methylphenyl)butoxy]-(4-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | pentyl (2S)-2-[[[2-amino-2-(hydroxymethyl)-4-(4-methylphenyl)butoxy]-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138514999 |
| Molecular Formula | C27H41N2O7P |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | pentyl (2S)-2-[[[2-amino-2-(hydroxymethyl)-4-(4-methylphenyl)butoxy]-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCCOC(=O)[C@H](C)NP(=O)(OCC(N)(CO)CCc1ccc(C)cc1)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H41N2O7P/c1-5-6-7-18-34-26(31)22(3)29-37(32,36-25-14-12-24(33-4)13-15-25)35-20-27(28,19-30)17-16-23-10-8-21(2)9-11-23/h8-15,22,30H,5-7,16-20,28H2,1-4H3,(H,29,32)/t22-,27?,37?/m0/s1 |
| InChIKey | RXZZIIBJRGZMCN-CFXXXXGFSA-N |
| XLogP | 4.54 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|