C15H15ClN2O4 — CID 139056228
(1R)-1-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol chloride (PubChem CID 139056228) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is (1R)-1-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol chloride.
| Compound Name | (1R)-1-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol chloride |
|---|---|
| PubChem CID | 139056228 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (1R)-1-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinolin-2-ium-6,7-diol chloride |
| SMILES | O=[N+]([O-])c1ccc([C@H]2[NH2+]CCc3cc(O)c(O)cc32)cc1.[Cl-] |
| InChI | InChI=1S/C15H14N2O4.ClH/c18-13-7-10-5-6-16-15(12(10)8-14(13)19)9-1-3-11(4-2-9)17(20)21;/h1-4,7-8,15-16,18-19H,5-6H2;1H/t15-;/m1./s1 |
| InChIKey | ORLQPMKQNHYPPI-XFULWGLBSA-N |
| XLogP | -1.78 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|