About 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide
2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide (PubChem CID 139060084) has the molecular formula C8H8N2O5
and a molecular weight of 212.16 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide |
| PubChem CID | 139060084 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[nH+]c1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C6H6N2O.C2H2O4/c7-6(9)5-2-1-3-8-4-5;3-1(4)2(5)6/h1-4H,(H2,7,9);(H,3,4)(H,5,6) |
| InChIKey | WYFWXYOEYGGTON-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide?
The IUPAC name of 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide (CID 139060084) is 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide?
The canonical SMILES for 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide is NC(=O)c1ccc[nH+]c1.O=C([O-])C(=O)O.
What is the InChIKey of 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide?
The InChIKey is WYFWXYOEYGGTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C2H2O4/c7-6(9)5-2-1-3-8-4-5;3-1(4)2(5)6/h1-4H,(H2,7,9);(H,3,4)(H,5,6).
What are the key properties of 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide?
2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide has a molecular weight of 212.16 g/mol, XLogP of -2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;pyridin-1-ium-3-carboxamide is sourced from PubChem (CID 139060084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).