C56H76MoN2O6-6 — CID 139142287
molybdenum;bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) (PubChem CID 139142287) has the molecular formula C56H76MoN2O6-6 and a molecular weight of 969.17 g/mol. Its IUPAC name is molybdenum;bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate).
| Compound Name | molybdenum;bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) |
|---|---|
| PubChem CID | 139142287 |
| Molecular Formula | C56H76MoN2O6-6 |
| Molecular Weight | 969.17 g/mol |
| Exact Mass | 970.48 |
| IUPAC Name | molybdenum;bis(2,4,6,8-tetratert-butylphenoxazin-10-ide-1,9-diolate) |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1[O-])[N-]c1c([O-])c(C(C)(C)C)cc(C(C)(C)C)c1O2.CC(C)(C)c1cc(C(C)(C)C)c2c(c1[O-])[N-]c1c([O-])c(C(C)(C)C)cc(C(C)(C)C)c1O2.[Mo] |
| InChI | InChI=1S/2C28H40NO3.Mo/c2*1-25(2,3)15-13-17(27(7,8)9)23-19(21(15)30)29-20-22(31)16(26(4,5)6)14-18(24(20)32-23)28(10,11)12;/h2*13-14,30-31H,1-12H3;/q2*-1;/p-4 |
| InChIKey | XUECDZNLICXCPE-UHFFFAOYSA-J |
| XLogP | 14.93 |
| TPSA | 138.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.17 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |