C14H15NO5 — CID 139186711
(S)-[(1S,2R)-1,2-dimethyl-3-methylidenecyclopropyl]-(6-nitro-1,3-benzodioxol-5-yl)methanol (PubChem CID 139186711) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (S)-[(1S,2R)-1,2-dimethyl-3-methylidenecyclopropyl]-(6-nitro-1,3-benzodioxol-5-yl)methanol.
| Compound Name | (S)-[(1S,2R)-1,2-dimethyl-3-methylidenecyclopropyl]-(6-nitro-1,3-benzodioxol-5-yl)methanol |
|---|---|
| PubChem CID | 139186711 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (S)-[(1S,2R)-1,2-dimethyl-3-methylidenecyclopropyl]-(6-nitro-1,3-benzodioxol-5-yl)methanol |
| SMILES | C=C1[C@@H](C)[C@]1(C)[C@H](O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C14H15NO5/c1-7-8(2)14(7,3)13(16)9-4-11-12(20-6-19-11)5-10(9)15(17)18/h4-5,8,13,16H,1,6H2,2-3H3/t8-,13-,14-/m1/s1 |
| InChIKey | BJUMRWSKLRPOIC-GFWSLJDESA-N |
| XLogP | 2.57 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|