C13H22O12S2 — CID 139420621
4-O-(2-methoxycarbonyloxypropyl) 1-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] butane-1,4-disulfonate (PubChem CID 139420621) has the molecular formula C13H22O12S2 and a molecular weight of 434.44 g/mol. Its IUPAC name is 4-O-(2-methoxycarbonyloxypropyl) 1-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] butane-1,4-disulfonate.
| Compound Name | 4-O-(2-methoxycarbonyloxypropyl) 1-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] butane-1,4-disulfonate |
|---|---|
| PubChem CID | 139420621 |
| Molecular Formula | C13H22O12S2 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 4-O-(2-methoxycarbonyloxypropyl) 1-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] butane-1,4-disulfonate |
| SMILES | COC(=O)OC(C)COS(=O)(=O)CCCCS(=O)(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C13H22O12S2/c1-10(24-12(14)20-2)7-22-26(16,17)5-3-4-6-27(18,19)23-9-11-8-21-13(15)25-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | KSPGVACZSPCMDD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|