C32H27F2N3O7S2 — CID 139542626
1-(3,5-difluoro-4-hydroxyphenyl)-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 139542626) has the molecular formula C32H27F2N3O7S2 and a molecular weight of 667.71 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-hydroxyphenyl)-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-(3,5-difluoro-4-hydroxyphenyl)-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139542626 |
| Molecular Formula | C32H27F2N3O7S2 |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 667.13 |
| IUPAC Name | 1-(3,5-difluoro-4-hydroxyphenyl)-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | O=C(c1ccc(SC2=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C(=O)N(c3cc(F)c(O)c(F)c3)C2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C32H27F2N3O7S2/c33-24-17-21(18-25(34)26(24)38)37-31(41)27(45-22-5-1-19(2-6-22)29(39)35-9-13-43-14-10-35)28(32(37)42)46-23-7-3-20(4-8-23)30(40)36-11-15-44-16-12-36/h1-8,17-18,38H,9-16H2 |
| InChIKey | XNGBWLZIKMQZTP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|