C32H34O6S — CID 139559481
3-[4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 139559481) has the molecular formula C32H34O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is 3-[4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-[4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 139559481 |
| Molecular Formula | C32H34O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3-[4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | C=CCOc1cc(-c2c(C)cc(C)c(S(=O)(=O)O)c2C)ccc1C1=Cc2ccc3c(c2OC1)CCC(C)(C)O3 |
| InChI | InChI=1S/C32H34O6S/c1-7-14-36-28-17-22(29-19(2)15-20(3)31(21(29)4)39(33,34)35)8-10-25(28)24-16-23-9-11-27-26(30(23)37-18-24)12-13-32(5,6)38-27/h7-11,15-17H,1,12-14,18H2,2-6H3,(H,33,34,35) |
| InChIKey | HNCZUDOEZDLVNT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|