C13H28Cl2N2 — CID 139622947
1,13-dichlorotridecane-3,11-diamine (PubChem CID 139622947) has the molecular formula C13H28Cl2N2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 1,13-dichlorotridecane-3,11-diamine.
| Compound Name | 1,13-dichlorotridecane-3,11-diamine |
|---|---|
| PubChem CID | 139622947 |
| Molecular Formula | C13H28Cl2N2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1,13-dichlorotridecane-3,11-diamine |
| SMILES | NC(CCCl)CCCCCCCC(N)CCCl |
| InChI | InChI=1S/C13H28Cl2N2/c14-10-8-12(16)6-4-2-1-3-5-7-13(17)9-11-15/h12-13H,1-11,16-17H2 |
| InChIKey | SPDQEKZIKVLFRJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|