C15H16F6O4 — CID 139640325
bis[2-(trifluoromethyl)cyclobutyl] 2-methylidenebutanedioate (PubChem CID 139640325) has the molecular formula C15H16F6O4 and a molecular weight of 374.28 g/mol. Its IUPAC name is bis[2-(trifluoromethyl)cyclobutyl] 2-methylidenebutanedioate.
| Compound Name | bis[2-(trifluoromethyl)cyclobutyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 139640325 |
| Molecular Formula | C15H16F6O4 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | bis[2-(trifluoromethyl)cyclobutyl] 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CCC1C(F)(F)F)C(=O)OC1CCC1C(F)(F)F |
| InChI | InChI=1S/C15H16F6O4/c1-7(13(23)25-11-5-3-9(11)15(19,20)21)6-12(22)24-10-4-2-8(10)14(16,17)18/h8-11H,1-6H2 |
| InChIKey | ZRZZQDRCMMXARQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|