C40H47BrF2N4O5 — CID 139964180
7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-4-oxo-N-prop-2-enylquinoline-3-carboxamide bromide (PubChem CID 139964180) has the molecular formula C40H47BrF2N4O5 and a molecular weight of 781.74 g/mol. Its IUPAC name is 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-4-oxo-N-prop-2-enylquinoline-3-carboxamide bromide.
| Compound Name | 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-4-oxo-N-prop-2-enylquinoline-3-carboxamide bromide |
|---|---|
| PubChem CID | 139964180 |
| Molecular Formula | C40H47BrF2N4O5 |
| Molecular Weight | 781.74 g/mol |
| Exact Mass | 780.27 |
| IUPAC Name | 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-4-oxo-N-prop-2-enylquinoline-3-carboxamide bromide |
| SMILES | C=CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(OCCCCCCC[N+]34CCN(CC3)CC4)ccc2c1=O)c1cc(F)cc(F)c1.[Br-] |
| InChI | InChI=1S/C40H47F2N4O5.BrH/c1-4-12-44(31-22-29(41)21-30(42)23-31)40(48)37-28-45(32-24-34(49-2)26-35(25-32)50-3)38-27-33(10-11-36(38)39(37)47)51-20-9-7-5-6-8-16-46-17-13-43(14-18-46)15-19-46;/h4,10-11,21-28H,1,5-9,12-20H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | VPPCCDIWDCNMJY-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|