C20H22F3IN4O6 — CID 140572987
(3Z)-4,5-difluoro-6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-3-[2-(2-hydroxyethylamino)-2-oxoethoxy]imino-2-methylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 140572987) has the molecular formula C20H22F3IN4O6 and a molecular weight of 598.32 g/mol. Its IUPAC name is (3Z)-4,5-difluoro-6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-3-[2-(2-hydroxyethylamino)-2-oxoethoxy]imino-2-methylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | (3Z)-4,5-difluoro-6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-3-[2-(2-hydroxyethylamino)-2-oxoethoxy]imino-2-methylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 140572987 |
| Molecular Formula | C20H22F3IN4O6 |
| Molecular Weight | 598.32 g/mol |
| Exact Mass | 598.05 |
| IUPAC Name | (3Z)-4,5-difluoro-6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-3-[2-(2-hydroxyethylamino)-2-oxoethoxy]imino-2-methylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1=C(C(=O)NOCCO)C(Nc2ccc(I)cc2F)=C(F)C(F)/C1=N\OCC(=O)NCCO |
| InChI | InChI=1S/C20H22F3IN4O6/c1-10-15(20(32)28-33-7-6-30)19(26-13-3-2-11(24)8-12(13)21)17(23)16(22)18(10)27-34-9-14(31)25-4-5-29/h2-3,8,16,26,29-30H,4-7,9H2,1H3,(H,25,31)(H,28,32)/b27-18- |
| InChIKey | SPINFTWSJFTPKL-IMRQLAEWSA-N |
| XLogP | 1.21 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|