C33H43NO2Si — CID 140706236
2-[4-[(3Z)-6-[dimethyl(propan-2-yl)silyl]oxy-1,2-diphenylhexa-1,3-dienyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 140706236) has the molecular formula C33H43NO2Si and a molecular weight of 513.80 g/mol. Its IUPAC name is 2-[4-[(3Z)-6-[dimethyl(propan-2-yl)silyl]oxy-1,2-diphenylhexa-1,3-dienyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(3Z)-6-[dimethyl(propan-2-yl)silyl]oxy-1,2-diphenylhexa-1,3-dienyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 140706236 |
| Molecular Formula | C33H43NO2Si |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 2-[4-[(3Z)-6-[dimethyl(propan-2-yl)silyl]oxy-1,2-diphenylhexa-1,3-dienyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC(C)[Si](C)(C)OCC/C=C\C(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H43NO2Si/c1-27(2)37(5,6)36-25-14-13-19-32(28-15-9-7-10-16-28)33(29-17-11-8-12-18-29)30-20-22-31(23-21-30)35-26-24-34(3)4/h7-13,15-23,27H,14,24-26H2,1-6H3/b19-13-,33-32? |
| InChIKey | BIVVVDBVUMFZOY-ZCHAAVMXSA-N |
| XLogP | 8.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|