C32H40N2O3Si — CID 140800831
[(2S,6R)-4-benzyl-6-[2-(6-phenylmethoxy-2-pyridinyl)ethynyl]morpholin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140800831) has the molecular formula C32H40N2O3Si and a molecular weight of 528.77 g/mol. Its IUPAC name is [(2S,6R)-4-benzyl-6-[2-(6-phenylmethoxy-2-pyridinyl)ethynyl]morpholin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,6R)-4-benzyl-6-[2-(6-phenylmethoxy-2-pyridinyl)ethynyl]morpholin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140800831 |
| Molecular Formula | C32H40N2O3Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [(2S,6R)-4-benzyl-6-[2-(6-phenylmethoxy-2-pyridinyl)ethynyl]morpholin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CN(Cc2ccccc2)C[C@@H](C#Cc2cccc(OCc3ccccc3)n2)O1 |
| InChI | InChI=1S/C32H40N2O3Si/c1-32(2,3)38(4,5)36-25-30-23-34(21-26-13-8-6-9-14-26)22-29(37-30)20-19-28-17-12-18-31(33-28)35-24-27-15-10-7-11-16-27/h6-18,29-30H,21-25H2,1-5H3/t29-,30+/m1/s1 |
| InChIKey | DFBNUTQJTZQKMN-IHLOFXLRSA-N |
| XLogP | 6.30 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|