C26H37N3O3Si — CID 140800854
4-[2-[(2R,6S)-4-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-2-yl]ethynyl]-2-methoxypyridin-3-amine (PubChem CID 140800854) has the molecular formula C26H37N3O3Si and a molecular weight of 467.69 g/mol. Its IUPAC name is 4-[2-[(2R,6S)-4-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-2-yl]ethynyl]-2-methoxypyridin-3-amine.
| Compound Name | 4-[2-[(2R,6S)-4-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-2-yl]ethynyl]-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 140800854 |
| Molecular Formula | C26H37N3O3Si |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-[2-[(2R,6S)-4-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-2-yl]ethynyl]-2-methoxypyridin-3-amine |
| SMILES | COc1nccc(C#C[C@@H]2CN(Cc3ccccc3)C[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c1N |
| InChI | InChI=1S/C26H37N3O3Si/c1-26(2,3)33(5,6)31-19-23-18-29(16-20-10-8-7-9-11-20)17-22(32-23)13-12-21-14-15-28-25(30-4)24(21)27/h7-11,14-15,22-23H,16-19,27H2,1-6H3/t22-,23+/m1/s1 |
| InChIKey | PVKWSTLROJBCPP-PKTZIBPZSA-N |
| XLogP | 4.32 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|