C16H32O4Si — CID 140857076
(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxan-3-ol (PubChem CID 140857076) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 140857076 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxan-3-ol |
| SMILES | C=C[C@H](C)[C@@H]1O[C@H](CO)[C@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-8-11(2)15-13(9-12(18)14(10-17)19-15)20-21(6,7)16(3,4)5/h8,11-15,17-18H,1,9-10H2,2-7H3/t11-,12+,13-,14+,15-/m0/s1 |
| InChIKey | XWRYHGMQDZWXDU-ZQNQSHIBSA-N |
| XLogP | 2.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|