C16H18FNOSi — CID 140898393
6-fluoro-3,3-dimethyl-1-(2-trimethylsilylethynyl)isoquinolin-4-one (PubChem CID 140898393) has the molecular formula C16H18FNOSi and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-fluoro-3,3-dimethyl-1-(2-trimethylsilylethynyl)isoquinolin-4-one.
| Compound Name | 6-fluoro-3,3-dimethyl-1-(2-trimethylsilylethynyl)isoquinolin-4-one |
|---|---|
| PubChem CID | 140898393 |
| Molecular Formula | C16H18FNOSi |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 6-fluoro-3,3-dimethyl-1-(2-trimethylsilylethynyl)isoquinolin-4-one |
| SMILES | CC1(C)N=C(C#C[Si](C)(C)C)c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C16H18FNOSi/c1-16(2)15(19)13-10-11(17)6-7-12(13)14(18-16)8-9-20(3,4)5/h6-7,10H,1-5H3 |
| InChIKey | MPCGLHWNMVDTGK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|