C15H14F3I3O2 — CID 140917261
[5,5,5-trifluoro-2-(3,4,5-triiodophenyl)pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 140917261) has the molecular formula C15H14F3I3O2 and a molecular weight of 663.98 g/mol. Its IUPAC name is [5,5,5-trifluoro-2-(3,4,5-triiodophenyl)pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [5,5,5-trifluoro-2-(3,4,5-triiodophenyl)pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140917261 |
| Molecular Formula | C15H14F3I3O2 |
| Molecular Weight | 663.98 g/mol |
| Exact Mass | 663.81 |
| IUPAC Name | [5,5,5-trifluoro-2-(3,4,5-triiodophenyl)pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCC(F)(F)F)c1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C15H14F3I3O2/c1-8(2)13(22)23-14(3,4-5-15(16,17)18)9-6-10(19)12(21)11(20)7-9/h6-7H,1,4-5H2,2-3H3 |
| InChIKey | GNVRBMZHPANKAA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|