C32H41F3O6 — CID 90369637
[6-[4-[5,5,5-trifluoro-2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]oxan-2-yl]methyl adamantane-1-carboxylate (PubChem CID 90369637) has the molecular formula C32H41F3O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is [6-[4-[5,5,5-trifluoro-2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]oxan-2-yl]methyl adamantane-1-carboxylate.
| Compound Name | [6-[4-[5,5,5-trifluoro-2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]oxan-2-yl]methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 90369637 |
| Molecular Formula | C32H41F3O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | [6-[4-[5,5,5-trifluoro-2-(2-methylprop-2-enoyloxy)pentan-2-yl]phenoxy]oxan-2-yl]methyl adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC(C)(CCC(F)(F)F)c1ccc(OC2CCCC(COC(=O)C34CC5CC(CC(C5)C3)C4)O2)cc1 |
| InChI | InChI=1S/C32H41F3O6/c1-20(2)28(36)41-30(3,11-12-32(33,34)35)24-7-9-25(10-8-24)39-27-6-4-5-26(40-27)19-38-29(37)31-16-21-13-22(17-31)15-23(14-21)18-31/h7-10,21-23,26-27H,1,4-6,11-19H2,2-3H3 |
| InChIKey | RRTKNWYFPSDDEC-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|