C13H6Br4O6 — CID 140926207
(2,3-dibromo-4,5-dihydroxyphenyl)-(2,6-dibromo-3,4,5-trihydroxyphenyl)methanone (PubChem CID 140926207) has the molecular formula C13H6Br4O6 and a molecular weight of 577.80 g/mol. Its IUPAC name is (2,3-dibromo-4,5-dihydroxyphenyl)-(2,6-dibromo-3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (2,3-dibromo-4,5-dihydroxyphenyl)-(2,6-dibromo-3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 140926207 |
| Molecular Formula | C13H6Br4O6 |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 573.69 |
| IUPAC Name | (2,3-dibromo-4,5-dihydroxyphenyl)-(2,6-dibromo-3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(Br)c1Br)c1c(Br)c(O)c(O)c(O)c1Br |
| InChI | InChI=1S/C13H6Br4O6/c14-5-2(1-3(18)10(20)8(5)17)9(19)4-6(15)11(21)13(23)12(22)7(4)16/h1,18,20-23H |
| InChIKey | RFPBTPPPZGFSKJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|