C15H26N2O5S — CID 141013625
5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-sulfonamide (PubChem CID 141013625) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is 5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-sulfonamide.
| Compound Name | 5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-sulfonamide |
|---|---|
| PubChem CID | 141013625 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5,9-dioxo-4-oxa-17-azabicyclo[14.1.0]heptadecane-17-sulfonamide |
| SMILES | NS(=O)(=O)N1C2CCCCCCC(=O)CCCC(=O)OCCC21 |
| InChI | InChI=1S/C15H26N2O5S/c16-23(20,21)17-13-8-4-2-1-3-6-12(18)7-5-9-15(19)22-11-10-14(13)17/h13-14H,1-11H2,(H2,16,20,21) |
| InChIKey | XERYLYHWXSCWAJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|