C21H27N7 — CID 141033321
N-[4-(3-aminopyrrolidin-1-yl)phenyl]-8-cyclopentyl-7H-pteridin-2-amine (PubChem CID 141033321) has the molecular formula C21H27N7 and a molecular weight of 377.50 g/mol. Its IUPAC name is N-[4-(3-aminopyrrolidin-1-yl)phenyl]-8-cyclopentyl-7H-pteridin-2-amine.
| Compound Name | N-[4-(3-aminopyrrolidin-1-yl)phenyl]-8-cyclopentyl-7H-pteridin-2-amine |
|---|---|
| PubChem CID | 141033321 |
| Molecular Formula | C21H27N7 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-[4-(3-aminopyrrolidin-1-yl)phenyl]-8-cyclopentyl-7H-pteridin-2-amine |
| SMILES | NC1CCN(c2ccc(Nc3ncc4c(n3)N(C3CCCC3)CC=N4)cc2)C1 |
| InChI | InChI=1S/C21H27N7/c22-15-9-11-27(14-15)17-7-5-16(6-8-17)25-21-24-13-19-20(26-21)28(12-10-23-19)18-3-1-2-4-18/h5-8,10,13,15,18H,1-4,9,11-12,14,22H2,(H,24,25,26) |
| InChIKey | SIRLRPPWIWHNNG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|