C35H49NO5 — CID 141051064
3-[4-[1-amino-1-(5-methylnonan-5-yloxy)pentyl]benzoyl]-2-butyl-1-benzofuran-5-carboxylic acid (PubChem CID 141051064) has the molecular formula C35H49NO5 and a molecular weight of 563.78 g/mol. Its IUPAC name is 3-[4-[1-amino-1-(5-methylnonan-5-yloxy)pentyl]benzoyl]-2-butyl-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-[4-[1-amino-1-(5-methylnonan-5-yloxy)pentyl]benzoyl]-2-butyl-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 141051064 |
| Molecular Formula | C35H49NO5 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 3-[4-[1-amino-1-(5-methylnonan-5-yloxy)pentyl]benzoyl]-2-butyl-1-benzofuran-5-carboxylic acid |
| SMILES | CCCCc1oc2ccc(C(=O)O)cc2c1C(=O)c1ccc(C(N)(CCCC)OC(C)(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C35H49NO5/c1-6-10-14-30-31(28-24-26(33(38)39)17-20-29(28)40-30)32(37)25-15-18-27(19-16-25)35(36,23-13-9-4)41-34(5,21-11-7-2)22-12-8-3/h15-20,24H,6-14,21-23,36H2,1-5H3,(H,38,39) |
| InChIKey | AADLIUUPCYGZBR-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|