C15H10N2O3 — CID 141087909
3-(1,4-benzodioxin-3-yl)-4H-pyrido[3,2-b][1,4]oxazine (PubChem CID 141087909) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(1,4-benzodioxin-3-yl)-4H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 3-(1,4-benzodioxin-3-yl)-4H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 141087909 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(1,4-benzodioxin-3-yl)-4H-pyrido[3,2-b][1,4]oxazine |
| SMILES | C1=C(C2=COc3ccccc3O2)Nc2ncccc2O1 |
| InChI | InChI=1S/C15H10N2O3/c1-2-5-12-11(4-1)19-9-14(20-12)10-8-18-13-6-3-7-16-15(13)17-10/h1-9H,(H,16,17) |
| InChIKey | QIOUOSNQJWYHPC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |