C16H25Cl2NO — CID 141188489
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-en-4-one;dihydrochloride (PubChem CID 141188489) has the molecular formula C16H25Cl2NO and a molecular weight of 318.29 g/mol. Its IUPAC name is (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-en-4-one;dihydrochloride.
| Compound Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-en-4-one;dihydrochloride |
|---|---|
| PubChem CID | 141188489 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-en-4-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCC2=C(C1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C16H23NO.2ClH/c18-12-5-4-11-9-15-13-3-1-2-6-16(13,7-8-17-15)14(11)10-12;;/h13,15,17H,1-10H2;2*1H/t13-,15+,16+;;/m0../s1 |
| InChIKey | KRFYEJFHVWKCJA-IZQURSCRSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|