C25H27NO2 — CID 141188540
[2-(3-cyclohexyl-1-prop-2-ynylindol-2-yl)-5-methoxyphenyl]methanol (PubChem CID 141188540) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [2-(3-cyclohexyl-1-prop-2-ynylindol-2-yl)-5-methoxyphenyl]methanol.
| Compound Name | [2-(3-cyclohexyl-1-prop-2-ynylindol-2-yl)-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 141188540 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [2-(3-cyclohexyl-1-prop-2-ynylindol-2-yl)-5-methoxyphenyl]methanol |
| SMILES | C#CCn1c(-c2ccc(OC)cc2CO)c(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C25H27NO2/c1-3-15-26-23-12-8-7-11-22(23)24(18-9-5-4-6-10-18)25(26)21-14-13-20(28-2)16-19(21)17-27/h1,7-8,11-14,16,18,27H,4-6,9-10,15,17H2,2H3 |
| InChIKey | DWWUXLJCGFGVIX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|