C15H17FIN3O3 — CID 141213513
5-[N-(2,3-dihydroxypropyl)-2-fluoro-4-iodoanilino]-2,4-dimethylpyridazin-3-one (PubChem CID 141213513) has the molecular formula C15H17FIN3O3 and a molecular weight of 433.22 g/mol. Its IUPAC name is 5-[N-(2,3-dihydroxypropyl)-2-fluoro-4-iodoanilino]-2,4-dimethylpyridazin-3-one.
| Compound Name | 5-[N-(2,3-dihydroxypropyl)-2-fluoro-4-iodoanilino]-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 141213513 |
| Molecular Formula | C15H17FIN3O3 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 5-[N-(2,3-dihydroxypropyl)-2-fluoro-4-iodoanilino]-2,4-dimethylpyridazin-3-one |
| SMILES | Cc1c(N(CC(O)CO)c2ccc(I)cc2F)cnn(C)c1=O |
| InChI | InChI=1S/C15H17FIN3O3/c1-9-14(6-18-19(2)15(9)23)20(7-11(22)8-21)13-4-3-10(17)5-12(13)16/h3-6,11,21-22H,7-8H2,1-2H3 |
| InChIKey | KVLFSLRBZZRGPX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|