C68H92O6P2 — CID 141277861
1-[[4-[4-bis(3,5-ditert-butylphenoxy)phosphorylphenyl]phenyl]-(3,5-ditert-butylphenoxy)phosphoryl]oxy-3,5-ditert-butylbenzene (PubChem CID 141277861) has the molecular formula C68H92O6P2 and a molecular weight of 1067.43 g/mol. Its IUPAC name is 1-[[4-[4-bis(3,5-ditert-butylphenoxy)phosphorylphenyl]phenyl]-(3,5-ditert-butylphenoxy)phosphoryl]oxy-3,5-ditert-butylbenzene.
| Compound Name | 1-[[4-[4-bis(3,5-ditert-butylphenoxy)phosphorylphenyl]phenyl]-(3,5-ditert-butylphenoxy)phosphoryl]oxy-3,5-ditert-butylbenzene |
|---|---|
| PubChem CID | 141277861 |
| Molecular Formula | C68H92O6P2 |
| Molecular Weight | 1067.43 g/mol |
| Exact Mass | 1066.64 |
| IUPAC Name | 1-[[4-[4-bis(3,5-ditert-butylphenoxy)phosphorylphenyl]phenyl]-(3,5-ditert-butylphenoxy)phosphoryl]oxy-3,5-ditert-butylbenzene |
| SMILES | CC(C)(C)c1cc(OP(=O)(Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccc(-c3ccc(P(=O)(Oc4cc(C(C)(C)C)cc(C(C)(C)C)c4)Oc4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H92O6P2/c1-61(2,3)47-33-48(62(4,5)6)38-55(37-47)71-75(69,72-56-39-49(63(7,8)9)34-50(40-56)64(10,11)12)59-29-25-45(26-30-59)46-27-31-60(32-28-46)76(70,73-57-41-51(65(13,14)15)35-52(42-57)66(16,17)18)74-58-43-53(67(19,20)21)36-54(44-58)68(22,23)24/h25-44H,1-24H3 |
| InChIKey | FSFPYFXSYYEHHF-UHFFFAOYSA-N |
| XLogP | 19.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.43 |
| LogP ≤ 5 | 19.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|