C14H19N3O — CID 141279766
(6R)-6-(3-aminophenyl)-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 141279766) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (6R)-6-(3-aminophenyl)-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | (6R)-6-(3-aminophenyl)-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 141279766 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (6R)-6-(3-aminophenyl)-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | CN1C=N[C@](C)(c2cccc(N)c2)C(C)(C)C1=O |
| InChI | InChI=1S/C14H19N3O/c1-13(2)12(18)17(4)9-16-14(13,3)10-6-5-7-11(15)8-10/h5-9H,15H2,1-4H3/t14-/m1/s1 |
| InChIKey | BPSPZNPBAKKJIA-CQSZACIVSA-N |
| XLogP | 2.01 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|