C12H10O3 — CID 141356919
4-methyl-5-(1-phenylethenyl)-1,3-dioxol-2-one (PubChem CID 141356919) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-methyl-5-(1-phenylethenyl)-1,3-dioxol-2-one.
| Compound Name | 4-methyl-5-(1-phenylethenyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 141356919 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-methyl-5-(1-phenylethenyl)-1,3-dioxol-2-one |
| SMILES | C=C(c1ccccc1)c1oc(=O)oc1C |
| InChI | InChI=1S/C12H10O3/c1-8(10-6-4-3-5-7-10)11-9(2)14-12(13)15-11/h3-7H,1H2,2H3 |
| InChIKey | SCJDIEOEWDQJLM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |